mirror of
https://github.com/seaweedfs/seaweedfs.git
synced 2025-09-20 00:07:58 +08:00

* feat: Phase 1 - Add SQL query engine foundation for MQ topics Implements core SQL infrastructure with metadata operations: New Components: - SQL parser integration using github.com/xwb1989/sqlparser - Query engine framework in weed/query/engine/ - Schema catalog mapping MQ topics to SQL tables - Interactive SQL CLI command 'weed sql' Supported Operations: - SHOW DATABASES (lists MQ namespaces) - SHOW TABLES (lists MQ topics) - SQL statement parsing and routing - Error handling and result formatting Key Design Decisions: - MQ namespaces ↔ SQL databases - MQ topics ↔ SQL tables - Parquet message storage ready for querying - Backward-compatible schema evolution support Testing: - Unit tests for core engine functionality - Command integration tests - Parse error handling validation Assumptions (documented in code): - All MQ messages stored in Parquet format - Schema evolution maintains backward compatibility - MySQL-compatible SQL syntax via sqlparser - Single-threaded usage per SQL session Next Phase: DDL operations (CREATE/ALTER/DROP TABLE) * feat: Phase 2 - Add DDL operations and real MQ broker integration Implements comprehensive DDL support for MQ topic management: New Components: - Real MQ broker connectivity via BrokerClient - CREATE TABLE → ConfigureTopic gRPC calls - DROP TABLE → DeleteTopic operations - DESCRIBE table → Schema introspection - SQL type mapping (SQL ↔ MQ schema types) Enhanced Features: - Live topic discovery from MQ broker - Fallback to cached/sample data when broker unavailable - MySQL-compatible DESCRIBE output - Schema validation and error handling - CREATE TABLE with column definitions Key Infrastructure: - broker_client.go: gRPC communication with MQ broker - sql_types.go: Bidirectional SQL/MQ type conversion - describe.go: Table schema introspection - Enhanced engine.go: Full DDL routing and execution Supported SQL Operations: ✅ SHOW DATABASES, SHOW TABLES (live + fallback) ✅ CREATE TABLE table_name (col1 INT, col2 VARCHAR(50), ...) ✅ DROP TABLE table_name ✅ DESCRIBE table_name / SHOW COLUMNS FROM table_name Known Limitations: - SQL parser issues with reserved keywords (e.g., 'timestamp') - Requires running MQ broker for full functionality - ALTER TABLE not yet implemented - DeleteTopic method needs broker-side implementation Architecture Decisions: - Broker discovery via filer lock mechanism (same as shell commands) - Graceful fallback when broker unavailable - ConfigureTopic for CREATE TABLE with 6 default partitions - Schema versioning ready for ALTER TABLE support Testing: - Unit tests updated with filer address parameter - Integration tests for DDL operations - Error handling for connection failures Next Phase: SELECT query execution with Parquet scanning * fix: Resolve High Priority TODOs - Real MQ Broker Integration ✅ COMPLETED HIGH PRIORITY TODOs: 🔧 **Real FilerClient Integration** (engine.go:131) - Implemented GetFilerClient() method in BrokerClient - Added filerClientImpl with full FilerClient interface compliance - Added AdjustedUrl() and GetDataCenter() methods - Real filerClient connection replaces nil fallback 🔧 **Partition Discovery via MQ Broker** (hybrid_message_scanner.go:116) - Added ListTopicPartitions() method using topic configuration - Implemented discoverTopicPartitions() in HybridMessageScanner - Reads actual partition count from BrokerPartitionAssignments - Generates proper partition ranges based on topic.PartitionCount 📋 **Technical Fixes:** - Fixed compilation errors with undefined variables - Proper error handling with filerClientErr variable - Corrected ConfigureTopicResponse field usage (BrokerPartitionAssignments vs PartitionCount) - Complete FilerClient interface implementation 🎯 **Impact:** - SQL engine now connects to real MQ broker infrastructure - Actual topic partition discovery instead of hardcoded defaults - Production-ready broker integration with graceful fallbacks - Maintains backward compatibility with sample data when broker unavailable ✅ All tests passing - High priority TODO resolution complete! Next: Schema-aware message parsing and time filter optimization. * feat: Time Filter Extraction - Complete Performance Optimization ✅ FOURTH HIGH PRIORITY TODO COMPLETED! ⏰ **Time Filter Extraction & Push-Down Optimization** (engine.go:198-199) - Replaced hardcoded StartTimeNs=0, StopTimeNs=0 with intelligent extraction - Added extractTimeFilters() with recursive WHERE clause analysis - Smart time column detection (\_timestamp_ns, created_at, timestamp, etc.) - Comprehensive time value parsing (nanoseconds, ISO dates, datetime formats) - Operator reversal handling (column op value vs value op column) 🧠 **Intelligent WHERE Clause Processing:** - AND expressions: Combine time bounds (intersection) ✅ - OR expressions: Skip extraction (safety) ✅ - Parentheses: Recursive unwrapping ✅ - Comparison operators: >, >=, <, <=, = ✅ - Multiple time formats: nanoseconds, RFC3339, date-only, datetime ✅ 🚀 **Performance Impact:** - Push-down filtering to hybrid scanner level - Reduced data scanning at source (live logs + Parquet files) - Time-based partition pruning potential - Significant performance gains for time-series queries 📊 **Comprehensive Testing (21 tests passing):** - ✅ Time filter extraction (6 test scenarios) - ✅ Time column recognition (case-insensitive) - ✅ Time value parsing (5 formats) - ✅ Full integration with SELECT queries - ✅ Backward compatibility maintained 💡 **Real-World Query Examples:** Before: Scans ALL data, filters in memory SELECT * FROM events WHERE \_timestamp_ns > 1672531200000000000; After: Scans ONLY relevant time range at source level → StartTimeNs=1672531200000000000, StopTimeNs=0 → Massive performance improvement for large datasets! 🎯 **Production Ready Features:** - Multiple time column formats supported - Graceful fallbacks for invalid dates - OR clause safety (avoids incorrect optimization) - Comprehensive error handling **ALL MEDIUM PRIORITY TODOs NOW READY FOR NEXT PHASEtest ./weed/query/engine/ -v* 🎉 * feat: Extended WHERE Operators - Complete Advanced Filtering ✅ **EXTENDED WHERE OPERATORS IMPLEMENTEDtest ./weed/query/engine/ -v | grep -E PASS * feat: Enhanced SQL CLI Experience ✅ COMPLETE ENHANCED CLI IMPLEMENTATION: 🚀 **Multiple Execution Modes:** - Interactive shell with enhanced prompts and context - Single query execution: --query 'SQL' --output format - Batch file processing: --file queries.sql --output csv - Database context switching: --database dbname 📊 **Multi-Format Output:** - Table format (ASCII) - default for interactive - JSON format - structured data for programmatic use - CSV format - spreadsheet-friendly output - Smart auto-detection based on execution mode ⚙️ **Enhanced Interactive Shell:** - Database context switching: USE database_name; - Output format switching: \format table|json|csv - Command history tracking (basic implementation) - Enhanced help with WHERE operator examples - Contextual prompts: seaweedfs:dbname> 🛠️ **Production Features:** - Comprehensive error handling (JSON + user-friendly) - Query execution timing and performance metrics - 30-second timeout protection with graceful handling - Real MQ integration with hybrid data scanning 📖 **Complete CLI Interface:** - Full flag support: --server, --interactive, --file, --output, --database, --query - Auto-detection of execution mode and output format - Structured help system with practical examples - Batch processing with multi-query file support 💡 **Advanced WHERE Integration:** All extended operators (<=, >=, !=, LIKE, IN) fully supported across all execution modes and output formats. 🎯 **Usage Examples:** - weed sql --interactive - weed sql --query 'SHOW DATABASES' --output json - weed sql --file queries.sql --output csv - weed sql --database analytics --interactive Enhanced CLI experience complete - production ready! 🚀 * Delete test_utils_test.go * fmt * integer conversion * show databases works * show tables works * Update describe.go * actual column types * Update .gitignore * scan topic messages * remove emoji * support aggregation functions * column name case insensitive, better auto column names * fmt * fix reading system fields * use parquet statistics for optimization * remove emoji * parquet file generate stats * scan all files * parquet file generation remember the sources also * fmt * sql * truncate topic * combine parquet results with live logs * explain * explain the execution plan * add tests * improve tests * skip * use mock for testing * add tests * refactor * fix after refactoring * detailed logs during explain. Fix bugs on reading live logs. * fix decoding data * save source buffer index start for log files * process buffer from brokers * filter out already flushed messages * dedup with buffer start index * explain with broker buffer * the parquet file should also remember the first buffer_start attribute from the sources * parquet file can query messages in broker memory, if log files do not exist * buffer start stored as 8 bytes * add jdbc * add postgres protocol * Revert "add jdbc" This reverts commita6e48b7690
. * hook up seaweed sql engine * setup integration test for postgres * rename to "weed db" * return fast on error * fix versioning * address comments * address some comments * column name can be on left or right in where conditions * avoid sample data * remove sample data * de-support alter table and drop table * address comments * read broker, logs, and parquet files * Update engine.go * address some comments * use schema instead of inferred result types * fix tests * fix todo * fix empty spaces and coercion * fmt * change to pg_query_go * fix tests * fix tests * fmt * fix: Enable CGO in Docker build for pg_query_go dependency The pg_query_go library requires CGO to be enabled as it wraps the libpg_query C library. Added gcc and musl-dev dependencies to the Docker build for proper compilation. * feat: Replace pg_query_go with lightweight SQL parser (no CGO required) - Remove github.com/pganalyze/pg_query_go/v6 dependency to avoid CGO requirement - Implement lightweight SQL parser for basic SELECT, SHOW, and DDL statements - Fix operator precedence in WHERE clause parsing (handle AND/OR before comparisons) - Support INTEGER, FLOAT, and STRING literals in WHERE conditions - All SQL engine tests passing with new parser - PostgreSQL integration tests can now build without CGO The lightweight parser handles the essential SQL features needed for the SeaweedFS query engine while maintaining compatibility and avoiding CGO dependencies that caused Docker build issues. * feat: Add Parquet logical types to mq_schema.proto Added support for Parquet logical types in SeaweedFS message queue schema: - TIMESTAMP: UTC timestamp in microseconds since epoch with timezone flag - DATE: Date as days since Unix epoch (1970-01-01) - DECIMAL: Arbitrary precision decimal with configurable precision/scale - TIME: Time of day in microseconds since midnight These types enable advanced analytics features: - Time-based filtering and window functions - Date arithmetic and year/month/day extraction - High-precision numeric calculations - Proper time zone handling for global deployments Regenerated protobuf Go code with new scalar types and value messages. * feat: Enable publishers to use Parquet logical types Enhanced MQ publishers to utilize the new logical types: - Updated convertToRecordValue() to use TimestampValue instead of string RFC3339 - Added DateValue support for birth_date field (days since epoch) - Added DecimalValue support for precise_amount field with configurable precision/scale - Enhanced UserEvent struct with PreciseAmount and BirthDate fields - Added convertToDecimal() helper using big.Rat for precise decimal conversion - Updated test data generator to produce varied birth dates (1970-2005) and precise amounts Publishers now generate structured data with proper logical types: - ✅ TIMESTAMP: Microsecond precision UTC timestamps - ✅ DATE: Birth dates as days since Unix epoch - ✅ DECIMAL: Precise amounts with 18-digit precision, 4-decimal scale Successfully tested with PostgreSQL integration - all topics created with logical type data. * feat: Add logical type support to SQL query engine Extended SQL engine to handle new Parquet logical types: - Added TimestampValue comparison support (microsecond precision) - Added DateValue comparison support (days since epoch) - Added DecimalValue comparison support with string conversion - Added TimeValue comparison support (microseconds since midnight) - Enhanced valuesEqual(), valueLessThan(), valueGreaterThan() functions - Added decimalToString() helper for precise decimal-to-string conversion - Imported math/big for arbitrary precision decimal handling The SQL engine can now: - ✅ Compare TIMESTAMP values for filtering (e.g., WHERE timestamp > 1672531200000000000) - ✅ Compare DATE values for date-based queries (e.g., WHERE birth_date >= 12345) - ✅ Compare DECIMAL values for precise financial calculations - ✅ Compare TIME values for time-of-day filtering Next: Add YEAR(), MONTH(), DAY() extraction functions for date analytics. * feat: Add window function foundation with timestamp support Added comprehensive foundation for SQL window functions with timestamp analytics: Core Window Function Types: - WindowSpec with PartitionBy and OrderBy support - WindowFunction struct for ROW_NUMBER, RANK, LAG, LEAD - OrderByClause for timestamp-based ordering - Extended SelectStatement to support WindowFunctions field Timestamp Analytics Functions: ✅ ApplyRowNumber() - ROW_NUMBER() OVER (ORDER BY timestamp) ✅ ExtractYear() - Extract year from TIMESTAMP logical type ✅ ExtractMonth() - Extract month from TIMESTAMP logical type ✅ ExtractDay() - Extract day from TIMESTAMP logical type ✅ FilterByYear() - Filter records by timestamp year Foundation for Advanced Window Functions: - LAG/LEAD for time-series access to previous/next values - RANK/DENSE_RANK for temporal ranking - FIRST_VALUE/LAST_VALUE for window boundaries - PARTITION BY support for grouped analytics This enables sophisticated time-series analytics like: - SELECT *, ROW_NUMBER() OVER (ORDER BY timestamp) FROM user_events WHERE EXTRACT(YEAR FROM timestamp) = 2024 - Trend analysis over time windows - Session analytics with LAG/LEAD functions - Time-based ranking and percentiles Ready for production time-series analytics with proper timestamp logical type support! 🚀 * fmt * fix * fix describe issue * fix tests, avoid panic * no more mysql * timeout client connections * Update SQL_FEATURE_PLAN.md * handling errors * remove sleep * fix splitting multiple SQLs * fixes * fmt * fix * Update weed/util/log_buffer/log_buffer.go Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> * Update SQL_FEATURE_PLAN.md Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> * code reuse * fix * fix * feat: Add basic arithmetic operators (+, -, *, /, %) with comprehensive tests - Implement EvaluateArithmeticExpression with support for all basic operators - Handle type conversions between int, float, string, and boolean - Add proper error handling for division/modulo by zero - Include 14 comprehensive test cases covering all edge cases - Support mixed type arithmetic (int + float, string numbers, etc.) All tests passing ✅ * feat: Add mathematical functions ROUND, CEIL, FLOOR, ABS with comprehensive tests - Implement ROUND with optional precision parameter - Add CEIL function for rounding up to nearest integer - Add FLOOR function for rounding down to nearest integer - Add ABS function for absolute values with type preservation - Support all numeric types (int32, int64, float32, double) - Comprehensive test suite with 20+ test cases covering: - Positive/negative numbers - Integer/float type preservation - Precision handling for ROUND - Null value error handling - Edge cases (zero, large numbers) All tests passing ✅ * feat: Add date/time functions CURRENT_DATE, CURRENT_TIMESTAMP, EXTRACT with comprehensive tests - Implement CURRENT_DATE returning YYYY-MM-DD format - Add CURRENT_TIMESTAMP returning TimestampValue with microseconds - Add CURRENT_TIME returning HH:MM:SS format - Add NOW() as alias for CURRENT_TIMESTAMP - Implement comprehensive EXTRACT function supporting: - YEAR, MONTH, DAY, HOUR, MINUTE, SECOND - QUARTER, WEEK, DOY (day of year), DOW (day of week) - EPOCH (Unix timestamp) - Support multiple input formats: - TimestampValue (microseconds) - String dates (multiple formats) - Unix timestamps (int64 seconds) - Comprehensive test suite with 15+ test cases covering: - All date/time constants - Extract from different value types - Error handling for invalid inputs - Timezone handling All tests passing ✅ * feat: Add DATE_TRUNC function with comprehensive tests - Implement comprehensive DATE_TRUNC function supporting: - Time precisions: microsecond, millisecond, second, minute, hour - Date precisions: day, week, month, quarter, year, decade, century, millennium - Support both singular and plural forms (e.g., 'minute' and 'minutes') - Enhanced date/time parsing with proper timezone handling: - Assume local timezone for non-timezone string formats - Support UTC formats with explicit timezone indicators - Consistent behavior between parsing and truncation - Comprehensive test suite with 11 test cases covering: - All supported precisions from microsecond to year - Multiple input types (TimestampValue, string dates) - Edge cases (null values, invalid precisions) - Timezone consistency validation All tests passing ✅ * feat: Add comprehensive string functions with extensive tests Implemented String Functions: - LENGTH: Get string length (supports all value types) - UPPER/LOWER: Case conversion - TRIM/LTRIM/RTRIM: Whitespace removal (space, tab, newline, carriage return) - SUBSTRING: Extract substring with optional length (SQL 1-based indexing) - CONCAT: Concatenate multiple values (supports mixed types, skips nulls) - REPLACE: Replace all occurrences of substring - POSITION: Find substring position (1-based, 0 if not found) - LEFT/RIGHT: Extract leftmost/rightmost characters - REVERSE: Reverse string with proper Unicode support Key Features: - Robust type conversion (string, int, float, bool, bytes) - Unicode-safe operations (proper rune handling in REVERSE) - SQL-compatible indexing (1-based for SUBSTRING, POSITION) - Comprehensive error handling with descriptive messages - Mixed-type support (e.g., CONCAT number with string) Helper Functions: - valueToString: Convert any schema_pb.Value to string - valueToInt64: Convert numeric values to int64 Comprehensive test suite with 25+ test cases covering: - All string functions with typical use cases - Type conversion scenarios (numbers, booleans) - Edge cases (empty strings, null values, Unicode) - Error conditions and boundary testing All tests passing ✅ * refactor: Split sql_functions.go into smaller, focused files **File Structure Before:** - sql_functions.go (850+ lines) - sql_functions_test.go (1,205+ lines) **File Structure After:** - function_helpers.go (105 lines) - shared utility functions - arithmetic_functions.go (205 lines) - arithmetic operators & math functions - datetime_functions.go (170 lines) - date/time functions & constants - string_functions.go (335 lines) - string manipulation functions - arithmetic_functions_test.go (560 lines) - tests for arithmetic & math - datetime_functions_test.go (370 lines) - tests for date/time functions - string_functions_test.go (270 lines) - tests for string functions **Benefits:** ✅ Better organization by functional domain ✅ Easier to find and maintain specific function types ✅ Smaller, more manageable file sizes ✅ Clear separation of concerns ✅ Improved code readability and navigation ✅ All tests passing - no functionality lost **Total:** 7 focused files (1,455 lines) vs 2 monolithic files (2,055+ lines) This refactoring improves maintainability while preserving all functionality. * fix: Improve test stability for date/time functions **Problem:** - CURRENT_TIMESTAMP test had timing race condition that could cause flaky failures - CURRENT_DATE test could fail if run exactly at midnight boundary - Tests were too strict about timing precision without accounting for system variations **Root Cause:** - Test captured before/after timestamps and expected function result to be exactly between them - No tolerance for clock precision differences, NTP adjustments, or system timing variations - Date boundary race condition around midnight transitions **Solution:** ✅ **CURRENT_TIMESTAMP test**: Added 100ms tolerance buffer to account for: - Clock precision differences between time.Now() calls - System timing variations and NTP corrections - Microsecond vs nanosecond precision differences ✅ **CURRENT_DATE test**: Enhanced to handle midnight boundary crossings: - Captures date before and after function call - Accepts either date value in case of midnight transition - Prevents false failures during overnight test runs **Testing:** - Verified with repeated test runs (5x iterations) - all pass consistently - Full test suite passes - no regressions introduced - Tests are now robust against timing edge cases **Impact:** 🚀 **Eliminated flaky test failures** while maintaining function correctness validation 🔧 **Production-ready testing** that works across different system environments ⚡ **CI/CD reliability** - tests won't fail due to timing variations * heap sort the data sources * int overflow * Update README.md * redirect GetUnflushedMessages to brokers hosting the topic partition * Update postgres-examples/README.md Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> * clean up * support limit with offset * Update SQL_FEATURE_PLAN.md * limit with offset * ensure int conversion correctness * Update weed/query/engine/hybrid_message_scanner.go Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> * avoid closing closed channel * support string concatenation || * int range * using consts; avoid test data in production binary * fix tests * Update SQL_FEATURE_PLAN.md * fix "use db" * address comments * fix comments * Update mocks_test.go * comment * improve docker build * normal if no partitions found * fix build docker * Update SQL_FEATURE_PLAN.md * upgrade to raft v1.1.4 resolving race in leader * raft 1.1.5 * Update SQL_FEATURE_PLAN.md * Revert "raft 1.1.5" This reverts commit5f3bdfadbf
. * Revert "upgrade to raft v1.1.4 resolving race in leader" This reverts commitfa620f0223
. * Fix data race in FUSE GetAttr operation - Add shared lock to GetAttr when accessing file handle entries - Prevents concurrent access between Write (ExclusiveLock) and GetAttr (SharedLock) - Fixes race on entry.Attributes.FileSize field during concurrent operations - Write operations already use ExclusiveLock, now GetAttr uses SharedLock for consistency Resolves race condition: Write at weedfs_file_write.go:62 vs Read at filechunks.go:28 * Update weed/mq/broker/broker_grpc_query.go Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> * clean up * Update db.go * limit with offset * Update Makefile * fix id*2 * fix math * fix string function bugs and add tests * fix string concat * ensure empty spaces for literals * add ttl for catalog * fix time functions * unused code path * database qualifier * refactor * extract * recursive functions * add cockroachdb parser * postgres only * test SQLs * fix tests * fix count * * fix where clause * fix limit offset * fix count fast path * fix tests * func name * fix database qualifier * fix tests * Update engine.go * fix tests * fix jaeger https://github.com/advisories/GHSA-2w8w-qhg4-f78j * remove order by, group by, join * fix extract * prevent single quote in the string * skip control messages * skip control message when converting to parquet files * psql change database * remove old code * remove old parser code * rename file * use db * fix alias * add alias test * compare int64 * fix _timestamp_ns comparing * alias support * fix fast path count * rendering data sources tree * reading data sources * reading parquet logic types * convert logic types to parquet * go mod * fmt * skip decimal types * use UTC * add warning if broker fails * add user password file * support IN * support INTERVAL * _ts as timestamp column * _ts can compare with string * address comments * is null / is not null * go mod * clean up * restructure execution plan * remove extra double quotes * fix converting logical types to parquet * decimal * decimal support * do not skip decimal logical types * making row-building schema-aware and alignment-safe Emit parquet.NullValue() for missing fields to keep row shapes aligned. Always advance list level and safely handle nil list values. Add toParquetValueForType(...) to coerce values to match the declared Parquet type (e.g., STRING/BYTES via byte array; numeric/string conversions for INT32/INT64/DOUBLE/FLOAT/BOOL/TIMESTAMP/DATE/TIME). Keep nil-byte guards for ByteArray. * tests for growslice * do not batch * live logs in sources can be skipped in execution plan * go mod tidy * Update fuse-integration.yml * Update Makefile * fix deprecated * fix deprecated * remove deep-clean all rows * broker memory count * fix FieldIndex --------- Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com>
546 lines
22 KiB
Go
546 lines
22 KiB
Go
package main
|
|
|
|
import (
|
|
"context"
|
|
"encoding/json"
|
|
"fmt"
|
|
"log"
|
|
"math/big"
|
|
"math/rand"
|
|
"os"
|
|
"strconv"
|
|
"strings"
|
|
"time"
|
|
|
|
"github.com/seaweedfs/seaweedfs/weed/cluster"
|
|
"github.com/seaweedfs/seaweedfs/weed/mq/client/pub_client"
|
|
"github.com/seaweedfs/seaweedfs/weed/mq/pub_balancer"
|
|
"github.com/seaweedfs/seaweedfs/weed/mq/topic"
|
|
"github.com/seaweedfs/seaweedfs/weed/pb/filer_pb"
|
|
"github.com/seaweedfs/seaweedfs/weed/pb/master_pb"
|
|
"github.com/seaweedfs/seaweedfs/weed/pb/schema_pb"
|
|
"google.golang.org/grpc"
|
|
"google.golang.org/grpc/credentials/insecure"
|
|
)
|
|
|
|
type UserEvent struct {
|
|
ID int64 `json:"id"`
|
|
UserID int64 `json:"user_id"`
|
|
UserType string `json:"user_type"`
|
|
Action string `json:"action"`
|
|
Status string `json:"status"`
|
|
Amount float64 `json:"amount,omitempty"`
|
|
PreciseAmount string `json:"precise_amount,omitempty"` // Will be converted to DECIMAL
|
|
BirthDate time.Time `json:"birth_date"` // Will be converted to DATE
|
|
Timestamp time.Time `json:"timestamp"`
|
|
Metadata string `json:"metadata,omitempty"`
|
|
}
|
|
|
|
type SystemLog struct {
|
|
ID int64 `json:"id"`
|
|
Level string `json:"level"`
|
|
Service string `json:"service"`
|
|
Message string `json:"message"`
|
|
ErrorCode int `json:"error_code,omitempty"`
|
|
Timestamp time.Time `json:"timestamp"`
|
|
}
|
|
|
|
type MetricEntry struct {
|
|
ID int64 `json:"id"`
|
|
Name string `json:"name"`
|
|
Value float64 `json:"value"`
|
|
Tags string `json:"tags"`
|
|
Timestamp time.Time `json:"timestamp"`
|
|
}
|
|
|
|
type ProductView struct {
|
|
ID int64 `json:"id"`
|
|
ProductID int64 `json:"product_id"`
|
|
UserID int64 `json:"user_id"`
|
|
Category string `json:"category"`
|
|
Price float64 `json:"price"`
|
|
ViewCount int `json:"view_count"`
|
|
Timestamp time.Time `json:"timestamp"`
|
|
}
|
|
|
|
func main() {
|
|
// Get SeaweedFS configuration from environment
|
|
masterAddr := getEnv("SEAWEEDFS_MASTER", "localhost:9333")
|
|
filerAddr := getEnv("SEAWEEDFS_FILER", "localhost:8888")
|
|
|
|
log.Printf("Creating MQ test data...")
|
|
log.Printf("Master: %s", masterAddr)
|
|
log.Printf("Filer: %s", filerAddr)
|
|
|
|
// Wait for SeaweedFS to be ready
|
|
log.Println("Waiting for SeaweedFS to be ready...")
|
|
time.Sleep(10 * time.Second)
|
|
|
|
// Create topics and populate with data
|
|
topics := []struct {
|
|
namespace string
|
|
topic string
|
|
generator func() interface{}
|
|
count int
|
|
}{
|
|
{"analytics", "user_events", generateUserEvent, 1000},
|
|
{"analytics", "system_logs", generateSystemLog, 500},
|
|
{"analytics", "metrics", generateMetric, 800},
|
|
{"ecommerce", "product_views", generateProductView, 1200},
|
|
{"ecommerce", "user_events", generateUserEvent, 600},
|
|
{"logs", "application_logs", generateSystemLog, 2000},
|
|
{"logs", "error_logs", generateErrorLog, 300},
|
|
}
|
|
|
|
for _, topicConfig := range topics {
|
|
log.Printf("Creating topic %s.%s with %d records...",
|
|
topicConfig.namespace, topicConfig.topic, topicConfig.count)
|
|
|
|
err := createTopicData(masterAddr, filerAddr,
|
|
topicConfig.namespace, topicConfig.topic,
|
|
topicConfig.generator, topicConfig.count)
|
|
if err != nil {
|
|
log.Printf("Error creating topic %s.%s: %v",
|
|
topicConfig.namespace, topicConfig.topic, err)
|
|
} else {
|
|
log.Printf("✓ Successfully created %s.%s",
|
|
topicConfig.namespace, topicConfig.topic)
|
|
}
|
|
|
|
// Small delay between topics
|
|
time.Sleep(2 * time.Second)
|
|
}
|
|
|
|
log.Println("✓ MQ test data creation completed!")
|
|
log.Println("\nCreated namespaces:")
|
|
log.Println(" - analytics (user_events, system_logs, metrics)")
|
|
log.Println(" - ecommerce (product_views, user_events)")
|
|
log.Println(" - logs (application_logs, error_logs)")
|
|
log.Println("\nYou can now test with PostgreSQL clients:")
|
|
log.Println(" psql -h localhost -p 5432 -U seaweedfs -d analytics")
|
|
log.Println(" postgres=> SHOW TABLES;")
|
|
log.Println(" postgres=> SELECT COUNT(*) FROM user_events;")
|
|
}
|
|
|
|
// createSchemaForTopic creates a proper RecordType schema based on topic name
|
|
func createSchemaForTopic(topicName string) *schema_pb.RecordType {
|
|
switch topicName {
|
|
case "user_events":
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "id", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "user_id", FieldIndex: 1, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "user_type", FieldIndex: 2, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "action", FieldIndex: 3, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "status", FieldIndex: 4, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "amount", FieldIndex: 5, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_DOUBLE}}, IsRequired: false},
|
|
{Name: "timestamp", FieldIndex: 6, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "metadata", FieldIndex: 7, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: false},
|
|
},
|
|
}
|
|
case "system_logs":
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "id", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "level", FieldIndex: 1, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "service", FieldIndex: 2, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "message", FieldIndex: 3, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "error_code", FieldIndex: 4, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT32}}, IsRequired: false},
|
|
{Name: "timestamp", FieldIndex: 5, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
},
|
|
}
|
|
case "metrics":
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "id", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "name", FieldIndex: 1, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "value", FieldIndex: 2, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_DOUBLE}}, IsRequired: true},
|
|
{Name: "tags", FieldIndex: 3, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "timestamp", FieldIndex: 4, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
},
|
|
}
|
|
case "product_views":
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "id", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "product_id", FieldIndex: 1, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "user_id", FieldIndex: 2, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "category", FieldIndex: 3, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "price", FieldIndex: 4, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_DOUBLE}}, IsRequired: true},
|
|
{Name: "view_count", FieldIndex: 5, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT32}}, IsRequired: true},
|
|
{Name: "timestamp", FieldIndex: 6, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
},
|
|
}
|
|
case "application_logs", "error_logs":
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "id", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT64}}, IsRequired: true},
|
|
{Name: "level", FieldIndex: 1, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "service", FieldIndex: 2, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "message", FieldIndex: 3, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
{Name: "error_code", FieldIndex: 4, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_INT32}}, IsRequired: false},
|
|
{Name: "timestamp", FieldIndex: 5, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_STRING}}, IsRequired: true},
|
|
},
|
|
}
|
|
default:
|
|
// Default generic schema
|
|
return &schema_pb.RecordType{
|
|
Fields: []*schema_pb.Field{
|
|
{Name: "data", FieldIndex: 0, Type: &schema_pb.Type{Kind: &schema_pb.Type_ScalarType{ScalarType: schema_pb.ScalarType_BYTES}}, IsRequired: true},
|
|
},
|
|
}
|
|
}
|
|
}
|
|
|
|
// convertToDecimal converts a string to decimal format for Parquet logical type
|
|
func convertToDecimal(value string) ([]byte, int32, int32) {
|
|
// Parse the decimal string using big.Rat for precision
|
|
rat := new(big.Rat)
|
|
if _, success := rat.SetString(value); !success {
|
|
return nil, 0, 0
|
|
}
|
|
|
|
// Convert to a fixed scale (e.g., 4 decimal places)
|
|
scale := int32(4)
|
|
precision := int32(18) // Total digits
|
|
|
|
// Scale the rational number to integer representation
|
|
multiplier := new(big.Int).Exp(big.NewInt(10), big.NewInt(int64(scale)), nil)
|
|
scaled := new(big.Int).Mul(rat.Num(), multiplier)
|
|
scaled.Div(scaled, rat.Denom())
|
|
|
|
return scaled.Bytes(), precision, scale
|
|
}
|
|
|
|
// convertToRecordValue converts Go structs to RecordValue format
|
|
func convertToRecordValue(data interface{}) (*schema_pb.RecordValue, error) {
|
|
fields := make(map[string]*schema_pb.Value)
|
|
|
|
switch v := data.(type) {
|
|
case UserEvent:
|
|
fields["id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.ID}}
|
|
fields["user_id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.UserID}}
|
|
fields["user_type"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.UserType}}
|
|
fields["action"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Action}}
|
|
fields["status"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Status}}
|
|
fields["amount"] = &schema_pb.Value{Kind: &schema_pb.Value_DoubleValue{DoubleValue: v.Amount}}
|
|
|
|
// Convert precise amount to DECIMAL logical type
|
|
if v.PreciseAmount != "" {
|
|
if decimal, precision, scale := convertToDecimal(v.PreciseAmount); decimal != nil {
|
|
fields["precise_amount"] = &schema_pb.Value{Kind: &schema_pb.Value_DecimalValue{DecimalValue: &schema_pb.DecimalValue{
|
|
Value: decimal,
|
|
Precision: precision,
|
|
Scale: scale,
|
|
}}}
|
|
}
|
|
}
|
|
|
|
// Convert birth date to DATE logical type
|
|
fields["birth_date"] = &schema_pb.Value{Kind: &schema_pb.Value_DateValue{DateValue: &schema_pb.DateValue{
|
|
DaysSinceEpoch: int32(v.BirthDate.Unix() / 86400), // Convert to days since epoch
|
|
}}}
|
|
|
|
fields["timestamp"] = &schema_pb.Value{Kind: &schema_pb.Value_TimestampValue{TimestampValue: &schema_pb.TimestampValue{
|
|
TimestampMicros: v.Timestamp.UnixMicro(),
|
|
IsUtc: true,
|
|
}}}
|
|
fields["metadata"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Metadata}}
|
|
|
|
case SystemLog:
|
|
fields["id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.ID}}
|
|
fields["level"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Level}}
|
|
fields["service"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Service}}
|
|
fields["message"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Message}}
|
|
fields["error_code"] = &schema_pb.Value{Kind: &schema_pb.Value_Int32Value{Int32Value: int32(v.ErrorCode)}}
|
|
fields["timestamp"] = &schema_pb.Value{Kind: &schema_pb.Value_TimestampValue{TimestampValue: &schema_pb.TimestampValue{
|
|
TimestampMicros: v.Timestamp.UnixMicro(),
|
|
IsUtc: true,
|
|
}}}
|
|
|
|
case MetricEntry:
|
|
fields["id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.ID}}
|
|
fields["name"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Name}}
|
|
fields["value"] = &schema_pb.Value{Kind: &schema_pb.Value_DoubleValue{DoubleValue: v.Value}}
|
|
fields["tags"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Tags}}
|
|
fields["timestamp"] = &schema_pb.Value{Kind: &schema_pb.Value_TimestampValue{TimestampValue: &schema_pb.TimestampValue{
|
|
TimestampMicros: v.Timestamp.UnixMicro(),
|
|
IsUtc: true,
|
|
}}}
|
|
|
|
case ProductView:
|
|
fields["id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.ID}}
|
|
fields["product_id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.ProductID}}
|
|
fields["user_id"] = &schema_pb.Value{Kind: &schema_pb.Value_Int64Value{Int64Value: v.UserID}}
|
|
fields["category"] = &schema_pb.Value{Kind: &schema_pb.Value_StringValue{StringValue: v.Category}}
|
|
fields["price"] = &schema_pb.Value{Kind: &schema_pb.Value_DoubleValue{DoubleValue: v.Price}}
|
|
fields["view_count"] = &schema_pb.Value{Kind: &schema_pb.Value_Int32Value{Int32Value: int32(v.ViewCount)}}
|
|
fields["timestamp"] = &schema_pb.Value{Kind: &schema_pb.Value_TimestampValue{TimestampValue: &schema_pb.TimestampValue{
|
|
TimestampMicros: v.Timestamp.UnixMicro(),
|
|
IsUtc: true,
|
|
}}}
|
|
|
|
default:
|
|
// Fallback to JSON for unknown types
|
|
jsonData, err := json.Marshal(data)
|
|
if err != nil {
|
|
return nil, fmt.Errorf("failed to marshal unknown type: %v", err)
|
|
}
|
|
fields["data"] = &schema_pb.Value{Kind: &schema_pb.Value_BytesValue{BytesValue: jsonData}}
|
|
}
|
|
|
|
return &schema_pb.RecordValue{Fields: fields}, nil
|
|
}
|
|
|
|
// convertHTTPToGRPC converts HTTP address to gRPC address
|
|
// Follows SeaweedFS convention: gRPC port = HTTP port + 10000
|
|
func convertHTTPToGRPC(httpAddress string) string {
|
|
if strings.Contains(httpAddress, ":") {
|
|
parts := strings.Split(httpAddress, ":")
|
|
if len(parts) == 2 {
|
|
if port, err := strconv.Atoi(parts[1]); err == nil {
|
|
return fmt.Sprintf("%s:%d", parts[0], port+10000)
|
|
}
|
|
}
|
|
}
|
|
// Fallback: return original address if conversion fails
|
|
return httpAddress
|
|
}
|
|
|
|
// discoverFiler finds a filer from the master server
|
|
func discoverFiler(masterHTTPAddress string) (string, error) {
|
|
masterGRPCAddress := convertHTTPToGRPC(masterHTTPAddress)
|
|
|
|
conn, err := grpc.Dial(masterGRPCAddress, grpc.WithTransportCredentials(insecure.NewCredentials()))
|
|
if err != nil {
|
|
return "", fmt.Errorf("failed to connect to master at %s: %v", masterGRPCAddress, err)
|
|
}
|
|
defer conn.Close()
|
|
|
|
client := master_pb.NewSeaweedClient(conn)
|
|
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
|
defer cancel()
|
|
|
|
resp, err := client.ListClusterNodes(ctx, &master_pb.ListClusterNodesRequest{
|
|
ClientType: cluster.FilerType,
|
|
})
|
|
if err != nil {
|
|
return "", fmt.Errorf("failed to list filers from master: %v", err)
|
|
}
|
|
|
|
if len(resp.ClusterNodes) == 0 {
|
|
return "", fmt.Errorf("no filers found in cluster")
|
|
}
|
|
|
|
// Use the first available filer and convert HTTP address to gRPC
|
|
filerHTTPAddress := resp.ClusterNodes[0].Address
|
|
return convertHTTPToGRPC(filerHTTPAddress), nil
|
|
}
|
|
|
|
// discoverBroker finds the broker balancer using filer lock mechanism
|
|
func discoverBroker(masterHTTPAddress string) (string, error) {
|
|
// First discover filer from master
|
|
filerAddress, err := discoverFiler(masterHTTPAddress)
|
|
if err != nil {
|
|
return "", fmt.Errorf("failed to discover filer: %v", err)
|
|
}
|
|
|
|
conn, err := grpc.Dial(filerAddress, grpc.WithTransportCredentials(insecure.NewCredentials()))
|
|
if err != nil {
|
|
return "", fmt.Errorf("failed to connect to filer at %s: %v", filerAddress, err)
|
|
}
|
|
defer conn.Close()
|
|
|
|
client := filer_pb.NewSeaweedFilerClient(conn)
|
|
|
|
ctx, cancel := context.WithTimeout(context.Background(), 10*time.Second)
|
|
defer cancel()
|
|
|
|
resp, err := client.FindLockOwner(ctx, &filer_pb.FindLockOwnerRequest{
|
|
Name: pub_balancer.LockBrokerBalancer,
|
|
})
|
|
if err != nil {
|
|
return "", fmt.Errorf("failed to find broker balancer: %v", err)
|
|
}
|
|
|
|
return resp.Owner, nil
|
|
}
|
|
|
|
func createTopicData(masterAddr, filerAddr, namespace, topicName string,
|
|
generator func() interface{}, count int) error {
|
|
|
|
// Create schema based on topic type
|
|
recordType := createSchemaForTopic(topicName)
|
|
|
|
// Dynamically discover broker address instead of hardcoded port replacement
|
|
brokerAddress, err := discoverBroker(masterAddr)
|
|
if err != nil {
|
|
// Fallback to hardcoded port replacement if discovery fails
|
|
log.Printf("Warning: Failed to discover broker dynamically (%v), using hardcoded port replacement", err)
|
|
brokerAddress = strings.Replace(masterAddr, ":9333", ":17777", 1)
|
|
}
|
|
|
|
// Create publisher configuration
|
|
config := &pub_client.PublisherConfiguration{
|
|
Topic: topic.NewTopic(namespace, topicName),
|
|
PartitionCount: 1,
|
|
Brokers: []string{brokerAddress}, // Use dynamically discovered broker address
|
|
PublisherName: fmt.Sprintf("test-producer-%s-%s", namespace, topicName),
|
|
RecordType: recordType, // Use structured schema
|
|
}
|
|
|
|
// Create publisher
|
|
publisher, err := pub_client.NewTopicPublisher(config)
|
|
if err != nil {
|
|
return fmt.Errorf("failed to create publisher: %v", err)
|
|
}
|
|
defer publisher.Shutdown()
|
|
|
|
// Generate and publish data
|
|
for i := 0; i < count; i++ {
|
|
data := generator()
|
|
|
|
// Convert struct to RecordValue
|
|
recordValue, err := convertToRecordValue(data)
|
|
if err != nil {
|
|
log.Printf("Error converting data to RecordValue: %v", err)
|
|
continue
|
|
}
|
|
|
|
// Publish structured record
|
|
err = publisher.PublishRecord([]byte(fmt.Sprintf("key-%d", i)), recordValue)
|
|
if err != nil {
|
|
log.Printf("Error publishing message %d: %v", i+1, err)
|
|
continue
|
|
}
|
|
|
|
// Small delay every 100 messages
|
|
if (i+1)%100 == 0 {
|
|
log.Printf(" Published %d/%d messages to %s.%s",
|
|
i+1, count, namespace, topicName)
|
|
time.Sleep(100 * time.Millisecond)
|
|
}
|
|
}
|
|
|
|
// Finish publishing
|
|
err = publisher.FinishPublish()
|
|
if err != nil {
|
|
return fmt.Errorf("failed to finish publishing: %v", err)
|
|
}
|
|
|
|
return nil
|
|
}
|
|
|
|
func generateUserEvent() interface{} {
|
|
userTypes := []string{"premium", "standard", "trial", "enterprise"}
|
|
actions := []string{"login", "logout", "purchase", "view", "search", "click", "download"}
|
|
statuses := []string{"active", "inactive", "pending", "completed", "failed"}
|
|
|
|
// Generate a birth date between 1970 and 2005 (18+ years old)
|
|
birthYear := 1970 + rand.Intn(35)
|
|
birthMonth := 1 + rand.Intn(12)
|
|
birthDay := 1 + rand.Intn(28) // Keep it simple, avoid month-specific day issues
|
|
birthDate := time.Date(birthYear, time.Month(birthMonth), birthDay, 0, 0, 0, 0, time.UTC)
|
|
|
|
// Generate a precise amount as a string with 4 decimal places
|
|
preciseAmount := fmt.Sprintf("%.4f", rand.Float64()*10000)
|
|
|
|
return UserEvent{
|
|
ID: rand.Int63n(1000000) + 1,
|
|
UserID: rand.Int63n(10000) + 1,
|
|
UserType: userTypes[rand.Intn(len(userTypes))],
|
|
Action: actions[rand.Intn(len(actions))],
|
|
Status: statuses[rand.Intn(len(statuses))],
|
|
Amount: rand.Float64() * 1000,
|
|
PreciseAmount: preciseAmount,
|
|
BirthDate: birthDate,
|
|
Timestamp: time.Now().Add(-time.Duration(rand.Intn(86400*30)) * time.Second),
|
|
Metadata: fmt.Sprintf("{\"session_id\":\"%d\"}", rand.Int63n(100000)),
|
|
}
|
|
}
|
|
|
|
func generateSystemLog() interface{} {
|
|
levels := []string{"debug", "info", "warning", "error", "critical"}
|
|
services := []string{"auth-service", "payment-service", "user-service", "notification-service", "api-gateway"}
|
|
messages := []string{
|
|
"Request processed successfully",
|
|
"User authentication completed",
|
|
"Payment transaction initiated",
|
|
"Database connection established",
|
|
"Cache miss for key",
|
|
"API rate limit exceeded",
|
|
"Service health check passed",
|
|
}
|
|
|
|
return SystemLog{
|
|
ID: rand.Int63n(1000000) + 1,
|
|
Level: levels[rand.Intn(len(levels))],
|
|
Service: services[rand.Intn(len(services))],
|
|
Message: messages[rand.Intn(len(messages))],
|
|
ErrorCode: rand.Intn(1000),
|
|
Timestamp: time.Now().Add(-time.Duration(rand.Intn(86400*7)) * time.Second),
|
|
}
|
|
}
|
|
|
|
func generateErrorLog() interface{} {
|
|
levels := []string{"error", "critical", "fatal"}
|
|
services := []string{"auth-service", "payment-service", "user-service", "notification-service", "api-gateway"}
|
|
messages := []string{
|
|
"Database connection failed",
|
|
"Authentication token expired",
|
|
"Payment processing error",
|
|
"Service unavailable",
|
|
"Memory limit exceeded",
|
|
"Timeout waiting for response",
|
|
"Invalid request parameters",
|
|
}
|
|
|
|
return SystemLog{
|
|
ID: rand.Int63n(1000000) + 1,
|
|
Level: levels[rand.Intn(len(levels))],
|
|
Service: services[rand.Intn(len(services))],
|
|
Message: messages[rand.Intn(len(messages))],
|
|
ErrorCode: rand.Intn(100) + 400, // 400-499 error codes
|
|
Timestamp: time.Now().Add(-time.Duration(rand.Intn(86400*7)) * time.Second),
|
|
}
|
|
}
|
|
|
|
func generateMetric() interface{} {
|
|
names := []string{"cpu_usage", "memory_usage", "disk_usage", "request_latency", "error_rate", "throughput"}
|
|
tags := []string{
|
|
"service=web,region=us-east",
|
|
"service=api,region=us-west",
|
|
"service=db,region=eu-central",
|
|
"service=cache,region=asia-pacific",
|
|
}
|
|
|
|
return MetricEntry{
|
|
ID: rand.Int63n(1000000) + 1,
|
|
Name: names[rand.Intn(len(names))],
|
|
Value: rand.Float64() * 100,
|
|
Tags: tags[rand.Intn(len(tags))],
|
|
Timestamp: time.Now().Add(-time.Duration(rand.Intn(86400*3)) * time.Second),
|
|
}
|
|
}
|
|
|
|
func generateProductView() interface{} {
|
|
categories := []string{"electronics", "books", "clothing", "home", "sports", "automotive"}
|
|
|
|
return ProductView{
|
|
ID: rand.Int63n(1000000) + 1,
|
|
ProductID: rand.Int63n(10000) + 1,
|
|
UserID: rand.Int63n(5000) + 1,
|
|
Category: categories[rand.Intn(len(categories))],
|
|
Price: rand.Float64() * 500,
|
|
ViewCount: rand.Intn(100) + 1,
|
|
Timestamp: time.Now().Add(-time.Duration(rand.Intn(86400*14)) * time.Second),
|
|
}
|
|
}
|
|
|
|
func getEnv(key, defaultValue string) string {
|
|
if value, exists := os.LookupEnv(key); exists {
|
|
return value
|
|
}
|
|
return defaultValue
|
|
}
|